C12H14F2N2OS — CID 81286345
3,5-difluoro-4-(4-hydroxypiperidin-1-yl)benzenecarbothioamide (PubChem CID 81286345) has the molecular formula C12H14F2N2OS and a molecular weight of 272.32 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-hydroxypiperidin-1-yl)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(4-hydroxypiperidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 81286345 |
| Molecular Formula | C12H14F2N2OS |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3,5-difluoro-4-(4-hydroxypiperidin-1-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(N2CCC(O)CC2)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2OS/c13-9-5-7(12(15)18)6-10(14)11(9)16-3-1-8(17)2-4-16/h5-6,8,17H,1-4H2,(H2,15,18) |
| InChIKey | SEJVEJFAHGOXMP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|