C14H17F2N3OS — CID 106318501
1-(4-carbamothioyl-2,6-difluorophenyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106318501) has the molecular formula C14H17F2N3OS and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-(4-carbamothioyl-2,6-difluorophenyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(4-carbamothioyl-2,6-difluorophenyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106318501 |
| Molecular Formula | C14H17F2N3OS |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-(4-carbamothioyl-2,6-difluorophenyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(c2c(F)cc(C(N)=S)cc2F)C1 |
| InChI | InChI=1S/C14H17F2N3OS/c1-14(13(20)18-2)3-4-19(7-14)11-9(15)5-8(12(17)21)6-10(11)16/h5-6H,3-4,7H2,1-2H3,(H2,17,21)(H,18,20) |
| InChIKey | SEDUQDJEVIKOCG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|