C15H19F2N3S — CID 81286105
3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarbothioamide (PubChem CID 81286105) has the molecular formula C15H19F2N3S and a molecular weight of 311.40 g/mol. Its IUPAC name is 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 81286105 |
| Molecular Formula | C15H19F2N3S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarbothioamide |
| SMILES | CN1C2CCC1CN(c1c(F)cc(C(N)=S)cc1F)CC2 |
| InChI | InChI=1S/C15H19F2N3S/c1-19-10-2-3-11(19)8-20(5-4-10)14-12(16)6-9(15(18)21)7-13(14)17/h6-7,10-11H,2-5,8H2,1H3,(H2,18,21) |
| InChIKey | DLDXMBSHZYMPPM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|