C16H22FN3S — CID 107879438
2-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide (PubChem CID 107879438) has the molecular formula C16H22FN3S and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107879438 |
| Molecular Formula | C16H22FN3S |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide |
| SMILES | CN1C2CCC1CN(Cc1ccc(F)c(C(N)=S)c1)CC2 |
| InChI | InChI=1S/C16H22FN3S/c1-19-12-3-4-13(19)10-20(7-6-12)9-11-2-5-15(17)14(8-11)16(18)21/h2,5,8,12-13H,3-4,6-7,9-10H2,1H3,(H2,18,21) |
| InChIKey | NXDGZSXOZCQEJP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|