C16H23N3S — CID 79174621
3-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide (PubChem CID 79174621) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 3-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 79174621 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarbothioamide |
| SMILES | CN1C2CCC1CN(Cc1cccc(C(N)=S)c1)CC2 |
| InChI | InChI=1S/C16H23N3S/c1-18-14-5-6-15(18)11-19(8-7-14)10-12-3-2-4-13(9-12)16(17)20/h2-4,9,14-15H,5-8,10-11H2,1H3,(H2,17,20) |
| InChIKey | IYLCTIRKQUEXLP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|