C14H18N2S — CID 54981209
3-(2-azabicyclo[2.2.1]heptan-2-ylmethyl)benzenecarbothioamide (PubChem CID 54981209) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-(2-azabicyclo[2.2.1]heptan-2-ylmethyl)benzenecarbothioamide.
| Compound Name | 3-(2-azabicyclo[2.2.1]heptan-2-ylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 54981209 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-(2-azabicyclo[2.2.1]heptan-2-ylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2CC3CCC2C3)c1 |
| InChI | InChI=1S/C14H18N2S/c15-14(17)12-3-1-2-10(6-12)8-16-9-11-4-5-13(16)7-11/h1-3,6,11,13H,4-5,7-9H2,(H2,15,17) |
| InChIKey | KZBWYHOLGJCCOM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|