C12H16N2S — CID 24694260
3-(pyrrolidin-1-ylmethyl)benzenecarbothioamide (PubChem CID 24694260) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 3-(pyrrolidin-1-ylmethyl)benzenecarbothioamide.
| Compound Name | 3-(pyrrolidin-1-ylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 24694260 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-(pyrrolidin-1-ylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C12H16N2S/c13-12(15)11-5-3-4-10(8-11)9-14-6-1-2-7-14/h3-5,8H,1-2,6-7,9H2,(H2,13,15) |
| InChIKey | BFAOYJRTRMOXFL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|