C18H21N3S — CID 39160651
3-[(4-phenylpiperazin-1-yl)methyl]benzenecarbothioamide (PubChem CID 39160651) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-[(4-phenylpiperazin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-[(4-phenylpiperazin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 39160651 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[(4-phenylpiperazin-1-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C18H21N3S/c19-18(22)16-6-4-5-15(13-16)14-20-9-11-21(12-10-20)17-7-2-1-3-8-17/h1-8,13H,9-12,14H2,(H2,19,22) |
| InChIKey | PMOPZHCLYFMYEW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|