C27H28N2O4 — CID 70248909
but-2-enedioic acid;1-phenyl-4-[(3-phenylphenyl)methyl]piperazine (PubChem CID 70248909) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is but-2-enedioic acid;1-phenyl-4-[(3-phenylphenyl)methyl]piperazine.
| Compound Name | but-2-enedioic acid;1-phenyl-4-[(3-phenylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 70248909 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | but-2-enedioic acid;1-phenyl-4-[(3-phenylphenyl)methyl]piperazine |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(-c2cccc(CN3CCN(c4ccccc4)CC3)c2)cc1 |
| InChI | InChI=1S/C23H24N2.C4H4O4/c1-3-9-21(10-4-1)22-11-7-8-20(18-22)19-24-14-16-25(17-15-24)23-12-5-2-6-13-23;5-3(6)1-2-4(7)8/h1-13,18H,14-17,19H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SSKYEQJVJQUOHV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|