C14H19FN2O — CID 114067125
3-fluoro-2-(3,3,4-trimethylpiperazin-1-yl)benzaldehyde (PubChem CID 114067125) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-fluoro-2-(3,3,4-trimethylpiperazin-1-yl)benzaldehyde.
| Compound Name | 3-fluoro-2-(3,3,4-trimethylpiperazin-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 114067125 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-fluoro-2-(3,3,4-trimethylpiperazin-1-yl)benzaldehyde |
| SMILES | CN1CCN(c2c(F)cccc2C=O)CC1(C)C |
| InChI | InChI=1S/C14H19FN2O/c1-14(2)10-17(8-7-16(14)3)13-11(9-18)5-4-6-12(13)15/h4-6,9H,7-8,10H2,1-3H3 |
| InChIKey | USKVXDFKCQWOOV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|