C14H18F2N2O2 — CID 107935740
2,3-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzoic acid (PubChem CID 107935740) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2,3-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzoic acid.
| Compound Name | 2,3-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 107935740 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2,3-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccc(C(=O)O)c(F)c2F)CC1(C)C |
| InChI | InChI=1S/C14H18F2N2O2/c1-14(2)8-18(7-6-17(14)3)10-5-4-9(13(19)20)11(15)12(10)16/h4-5H,6-8H2,1-3H3,(H,19,20) |
| InChIKey | GMPHZYPBYDGKRO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |