C16H26FN3 — CID 63609919
1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]-N-methylethanamine (PubChem CID 63609919) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]-N-methylethanamine.
| Compound Name | 1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 63609919 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(N2CCN(C)C(C)(C)C2)c(F)c1 |
| InChI | InChI=1S/C16H26FN3/c1-12(18-4)13-6-7-15(14(17)10-13)20-9-8-19(5)16(2,3)11-20/h6-7,10,12,18H,8-9,11H2,1-5H3 |
| InChIKey | HYSITIHANXQKKY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|