C13H15F2NOS — CID 106201734
4-(2-cyclobutylethoxy)-3,5-difluorobenzenecarbothioamide (PubChem CID 106201734) has the molecular formula C13H15F2NOS and a molecular weight of 271.33 g/mol. Its IUPAC name is 4-(2-cyclobutylethoxy)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(2-cyclobutylethoxy)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106201734 |
| Molecular Formula | C13H15F2NOS |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(2-cyclobutylethoxy)-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(OCCC2CCC2)c(F)c1 |
| InChI | InChI=1S/C13H15F2NOS/c14-10-6-9(13(16)18)7-11(15)12(10)17-5-4-8-2-1-3-8/h6-8H,1-5H2,(H2,16,18) |
| InChIKey | OXVLBFQNMJSFRF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|