C15H20F2N2S — CID 81286824
4-[cyclohexylmethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286824) has the molecular formula C15H20F2N2S and a molecular weight of 298.40 g/mol. Its IUPAC name is 4-[cyclohexylmethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[cyclohexylmethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286824 |
| Molecular Formula | C15H20F2N2S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[cyclohexylmethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CN(CC1CCCCC1)c1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C15H20F2N2S/c1-19(9-10-5-3-2-4-6-10)14-12(16)7-11(15(18)20)8-13(14)17/h7-8,10H,2-6,9H2,1H3,(H2,18,20) |
| InChIKey | WFGALWZEPKLYMA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|