C13H16F2N2S — CID 81286737
4-[1-cyclopropylethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286737) has the molecular formula C13H16F2N2S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[1-cyclopropylethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[1-cyclopropylethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286737 |
| Molecular Formula | C13H16F2N2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[1-cyclopropylethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CC(C1CC1)N(C)c1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C13H16F2N2S/c1-7(8-3-4-8)17(2)12-10(14)5-9(13(16)18)6-11(12)15/h5-8H,3-4H2,1-2H3,(H2,16,18) |
| InChIKey | ZTGCUJJHBRBBNK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|