C12H14F2N2O2S2 — CID 81286738
4-[(1,1-dioxothiolan-3-yl)-methylamino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286738) has the molecular formula C12H14F2N2O2S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286738 |
| Molecular Formula | C12H14F2N2O2S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CN(c1c(F)cc(C(N)=S)cc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14F2N2O2S2/c1-16(8-2-3-20(17,18)6-8)11-9(13)4-7(12(15)19)5-10(11)14/h4-5,8H,2-3,6H2,1H3,(H2,15,19) |
| InChIKey | CWVRWWDTNDTSFE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|