C13H18N2O2S2 — CID 107928586
2-[(1,1-dioxothiolan-3-yl)-methylamino]-5-methylbenzenecarbothioamide (PubChem CID 107928586) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-5-methylbenzenecarbothioamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107928586 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-5-methylbenzenecarbothioamide |
| SMILES | Cc1ccc(N(C)C2CCS(=O)(=O)C2)c(C(N)=S)c1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-9-3-4-12(11(7-9)13(14)18)15(2)10-5-6-19(16,17)8-10/h3-4,7,10H,5-6,8H2,1-2H3,(H2,14,18) |
| InChIKey | RVYSANZOWYOEQR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|