C13H18N2S2 — CID 107928532
5-methyl-2-[methyl(thiolan-3-yl)amino]benzenecarbothioamide (PubChem CID 107928532) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is 5-methyl-2-[methyl(thiolan-3-yl)amino]benzenecarbothioamide.
| Compound Name | 5-methyl-2-[methyl(thiolan-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107928532 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-methyl-2-[methyl(thiolan-3-yl)amino]benzenecarbothioamide |
| SMILES | Cc1ccc(N(C)C2CCSC2)c(C(N)=S)c1 |
| InChI | InChI=1S/C13H18N2S2/c1-9-3-4-12(11(7-9)13(14)16)15(2)10-5-6-17-8-10/h3-4,7,10H,5-6,8H2,1-2H3,(H2,14,16) |
| InChIKey | OAXIZFUUCVFOSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|