C12H15FN2S2 — CID 43657912
3-fluoro-4-[methyl(thiolan-3-yl)amino]benzenecarbothioamide (PubChem CID 43657912) has the molecular formula C12H15FN2S2 and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-fluoro-4-[methyl(thiolan-3-yl)amino]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[methyl(thiolan-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 43657912 |
| Molecular Formula | C12H15FN2S2 |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-fluoro-4-[methyl(thiolan-3-yl)amino]benzenecarbothioamide |
| SMILES | CN(c1ccc(C(N)=S)cc1F)C1CCSC1 |
| InChI | InChI=1S/C12H15FN2S2/c1-15(9-4-5-17-7-9)11-3-2-8(12(14)16)6-10(11)13/h2-3,6,9H,4-5,7H2,1H3,(H2,14,16) |
| InChIKey | KTIDNUPQUQHWNU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|