C12H15BrFN3OS — CID 107535827
2-bromo-3-fluoro-N'-hydroxy-4-[methyl(thiolan-3-yl)amino]benzenecarboximidamide (PubChem CID 107535827) has the molecular formula C12H15BrFN3OS and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(thiolan-3-yl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(thiolan-3-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107535827 |
| Molecular Formula | C12H15BrFN3OS |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(thiolan-3-yl)amino]benzenecarboximidamide |
| SMILES | CN(c1ccc(/C(N)=N/O)c(Br)c1F)C1CCSC1 |
| InChI | InChI=1S/C12H15BrFN3OS/c1-17(7-4-5-19-6-7)9-3-2-8(12(15)16-18)10(13)11(9)14/h2-3,7,18H,4-6H2,1H3,(H2,15,16) |
| InChIKey | FQHQEIBLLNHTQI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|