C14H19BrFN3O2 — CID 107535992
2-bromo-4-[2-(cyclopropylmethoxy)ethyl-methylamino]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107535992) has the molecular formula C14H19BrFN3O2 and a molecular weight of 360.23 g/mol. Its IUPAC name is 2-bromo-4-[2-(cyclopropylmethoxy)ethyl-methylamino]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-bromo-4-[2-(cyclopropylmethoxy)ethyl-methylamino]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107535992 |
| Molecular Formula | C14H19BrFN3O2 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-bromo-4-[2-(cyclopropylmethoxy)ethyl-methylamino]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(CCOCC1CC1)c1ccc(/C(N)=N/O)c(Br)c1F |
| InChI | InChI=1S/C14H19BrFN3O2/c1-19(6-7-21-8-9-2-3-9)11-5-4-10(14(17)18-20)12(15)13(11)16/h4-5,9,20H,2-3,6-8H2,1H3,(H2,17,18) |
| InChIKey | NRQSGSNKCBVNCW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|