C12H17BrFN3O2 — CID 107536019
2-bromo-4-[ethyl(3-hydroxypropyl)amino]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107536019) has the molecular formula C12H17BrFN3O2 and a molecular weight of 334.19 g/mol. Its IUPAC name is 2-bromo-4-[ethyl(3-hydroxypropyl)amino]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-bromo-4-[ethyl(3-hydroxypropyl)amino]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107536019 |
| Molecular Formula | C12H17BrFN3O2 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-bromo-4-[ethyl(3-hydroxypropyl)amino]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CCN(CCCO)c1ccc(/C(N)=N/O)c(Br)c1F |
| InChI | InChI=1S/C12H17BrFN3O2/c1-2-17(6-3-7-18)9-5-4-8(12(15)16-19)10(13)11(9)14/h4-5,18-19H,2-3,6-7H2,1H3,(H2,15,16) |
| InChIKey | OOKLICKELDTFDZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|