C13H18BrFN2OS — CID 107535123
2-bromo-4-[2-ethoxyethyl(ethyl)amino]-3-fluorobenzenecarbothioamide (PubChem CID 107535123) has the molecular formula C13H18BrFN2OS and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-bromo-4-[2-ethoxyethyl(ethyl)amino]-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-[2-ethoxyethyl(ethyl)amino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535123 |
| Molecular Formula | C13H18BrFN2OS |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-bromo-4-[2-ethoxyethyl(ethyl)amino]-3-fluorobenzenecarbothioamide |
| SMILES | CCOCCN(CC)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C13H18BrFN2OS/c1-3-17(7-8-18-4-2)10-6-5-9(13(16)19)11(14)12(10)15/h5-6H,3-4,7-8H2,1-2H3,(H2,16,19) |
| InChIKey | BQLWGESPCCRUKU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|