C13H17BrFN3OS — CID 107534890
2-(3-bromo-4-carbamothioyl-N-ethyl-2-fluoroanilino)-N-ethylacetamide (PubChem CID 107534890) has the molecular formula C13H17BrFN3OS and a molecular weight of 362.27 g/mol. Its IUPAC name is 2-(3-bromo-4-carbamothioyl-N-ethyl-2-fluoroanilino)-N-ethylacetamide.
| Compound Name | 2-(3-bromo-4-carbamothioyl-N-ethyl-2-fluoroanilino)-N-ethylacetamide |
|---|---|
| PubChem CID | 107534890 |
| Molecular Formula | C13H17BrFN3OS |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-(3-bromo-4-carbamothioyl-N-ethyl-2-fluoroanilino)-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C13H17BrFN3OS/c1-3-17-10(19)7-18(4-2)9-6-5-8(13(16)20)11(14)12(9)15/h5-6H,3-4,7H2,1-2H3,(H2,16,20)(H,17,19) |
| InChIKey | KIHJHNUQUKZRQL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|