C12H15FN2O2S — CID 55233299
methyl 2-(2-carbamothioyl-N-ethyl-4-fluoroanilino)acetate (PubChem CID 55233299) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 2-(2-carbamothioyl-N-ethyl-4-fluoroanilino)acetate.
| Compound Name | methyl 2-(2-carbamothioyl-N-ethyl-4-fluoroanilino)acetate |
|---|---|
| PubChem CID | 55233299 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | methyl 2-(2-carbamothioyl-N-ethyl-4-fluoroanilino)acetate |
| SMILES | CCN(CC(=O)OC)c1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C12H15FN2O2S/c1-3-15(7-11(16)17-2)10-5-4-8(13)6-9(10)12(14)18/h4-6H,3,7H2,1-2H3,(H2,14,18) |
| InChIKey | AUWNIZBVVLXEPT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|