C12H16FN3OS — CID 63674904
2-(2-carbamothioyl-4-fluoro-N-propan-2-ylanilino)acetamide (PubChem CID 63674904) has the molecular formula C12H16FN3OS and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(2-carbamothioyl-4-fluoro-N-propan-2-ylanilino)acetamide.
| Compound Name | 2-(2-carbamothioyl-4-fluoro-N-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 63674904 |
| Molecular Formula | C12H16FN3OS |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-(2-carbamothioyl-4-fluoro-N-propan-2-ylanilino)acetamide |
| SMILES | CC(C)N(CC(N)=O)c1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C12H16FN3OS/c1-7(2)16(6-11(14)17)10-4-3-8(13)5-9(10)12(15)18/h3-5,7H,6H2,1-2H3,(H2,14,17)(H2,15,18) |
| InChIKey | DTMUBCJDLXSYDS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|