C14H17FN2O2S — CID 63672880
ethyl 2-(2-carbamothioyl-N-cyclopropyl-4-fluoroanilino)acetate (PubChem CID 63672880) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 2-(2-carbamothioyl-N-cyclopropyl-4-fluoroanilino)acetate.
| Compound Name | ethyl 2-(2-carbamothioyl-N-cyclopropyl-4-fluoroanilino)acetate |
|---|---|
| PubChem CID | 63672880 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | ethyl 2-(2-carbamothioyl-N-cyclopropyl-4-fluoroanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(F)cc1C(N)=S)C1CC1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-2-19-13(18)8-17(10-4-5-10)12-6-3-9(15)7-11(12)14(16)20/h3,6-7,10H,2,4-5,8H2,1H3,(H2,16,20) |
| InChIKey | KHAPXBDZHUSJLS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|