C11H13F2NO2 — CID 115257298
ethyl 2-(2,4-difluoro-N-methylanilino)acetate (PubChem CID 115257298) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is ethyl 2-(2,4-difluoro-N-methylanilino)acetate.
| Compound Name | ethyl 2-(2,4-difluoro-N-methylanilino)acetate |
|---|---|
| PubChem CID | 115257298 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | ethyl 2-(2,4-difluoro-N-methylanilino)acetate |
| SMILES | CCOC(=O)CN(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2NO2/c1-3-16-11(15)7-14(2)10-5-4-8(12)6-9(10)13/h4-6H,3,7H2,1-2H3 |
| InChIKey | JKSUAPWZADJZCB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |