About methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate
methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate (PubChem CID 107934795) has the molecular formula C13H16F2N2O2S
and a molecular weight of 302.35 g/mol. Its IUPAC name is methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate |
| PubChem CID | 107934795 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(C(N)=S)c(F)c1F)C(C)C |
| InChI | InChI=1S/C13H16F2N2O2S/c1-7(2)17(6-10(18)19-3)9-5-4-8(13(16)20)11(14)12(9)15/h4-5,7H,6H2,1-3H3,(H2,16,20) |
| InChIKey | TUJXNTFOJWDYHE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate?
The IUPAC name of methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate (CID 107934795) is methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate.
What is the SMILES notation for methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate?
The canonical SMILES for methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate is COC(=O)CN(c1ccc(C(N)=S)c(F)c1F)C(C)C.
What is the InChIKey of methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate?
The InChIKey is TUJXNTFOJWDYHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O2S/c1-7(2)17(6-10(18)19-3)9-5-4-8(13(16)20)11(14)12(9)15/h4-5,7H,6H2,1-3H3,(H2,16,20).
What are the key properties of methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate?
methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate has a molecular weight of 302.35 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-carbamothioyl-2,3-difluoro-N-propan-2-ylanilino)acetate is sourced from PubChem (CID 107934795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).