C12H17N3O2S — CID 55007044
methyl 2-[(4-carbamothioyl-2-pyridinyl)-propan-2-ylamino]acetate (PubChem CID 55007044) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-[(4-carbamothioyl-2-pyridinyl)-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[(4-carbamothioyl-2-pyridinyl)-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 55007044 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 2-[(4-carbamothioyl-2-pyridinyl)-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(c1cc(C(N)=S)ccn1)C(C)C |
| InChI | InChI=1S/C12H17N3O2S/c1-8(2)15(7-11(16)17-3)10-6-9(12(13)18)4-5-14-10/h4-6,8H,7H2,1-3H3,(H2,13,18) |
| InChIKey | FVZGDFUSHLJZMG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|