C11H17N3O4S — CID 62004980
methyl 2-[propan-2-yl-(5-sulfamoyl-2-pyridinyl)amino]acetate (PubChem CID 62004980) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 2-[propan-2-yl-(5-sulfamoyl-2-pyridinyl)amino]acetate.
| Compound Name | methyl 2-[propan-2-yl-(5-sulfamoyl-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 62004980 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 2-[propan-2-yl-(5-sulfamoyl-2-pyridinyl)amino]acetate |
| SMILES | COC(=O)CN(c1ccc(S(N)(=O)=O)cn1)C(C)C |
| InChI | InChI=1S/C11H17N3O4S/c1-8(2)14(7-11(15)18-3)10-5-4-9(6-13-10)19(12,16)17/h4-6,8H,7H2,1-3H3,(H2,12,16,17) |
| InChIKey | WYEJMVRAVZNCIQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |