C9H13N3O4S — CID 60653849
methyl 3-[(5-sulfamoyl-2-pyridinyl)amino]propanoate (PubChem CID 60653849) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is methyl 3-[(5-sulfamoyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3-[(5-sulfamoyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 60653849 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | methyl 3-[(5-sulfamoyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)CCNc1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C9H13N3O4S/c1-16-9(13)4-5-11-8-3-2-7(6-12-8)17(10,14)15/h2-3,6H,4-5H2,1H3,(H,11,12)(H2,10,14,15) |
| InChIKey | ZOTPQTSUDTUBEQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |