C16H25N3O5S — CID 9107417
methyl 6-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]hexanoate (PubChem CID 9107417) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl 6-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]hexanoate.
| Compound Name | methyl 6-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]hexanoate |
|---|---|
| PubChem CID | 9107417 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl 6-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C16H25N3O5S/c1-23-16(20)5-3-2-4-8-17-15-7-6-14(13-18-15)25(21,22)19-9-11-24-12-10-19/h6-7,13H,2-5,8-12H2,1H3,(H,17,18) |
| InChIKey | CBBVWEKEABQZSN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|