C19H23N7O2S — CID 174852454
6-[2-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-sulfonamide (PubChem CID 174852454) has the molecular formula C19H23N7O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is 6-[2-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-sulfonamide.
| Compound Name | 6-[2-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 174852454 |
| Molecular Formula | C19H23N7O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-[2-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-sulfonamide |
| SMILES | Cc1cc(C)cc(-c2cc(NCCNc3ccc(S(N)(=O)=O)cn3)nc(N)n2)c1 |
| InChI | InChI=1S/C19H23N7O2S/c1-12-7-13(2)9-14(8-12)16-10-18(26-19(20)25-16)23-6-5-22-17-4-3-15(11-24-17)29(21,27)28/h3-4,7-11H,5-6H2,1-2H3,(H,22,24)(H2,21,27,28)(H3,20,23,25,26) |
| InChIKey | WVLUDUBCSZRCLO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|