C21H25N5O5S2 — CID 174933868
3-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]propyl 4-sulfamoylbenzenesulfonate (PubChem CID 174933868) has the molecular formula C21H25N5O5S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 3-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]propyl 4-sulfamoylbenzenesulfonate.
| Compound Name | 3-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]propyl 4-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 174933868 |
| Molecular Formula | C21H25N5O5S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[[2-amino-6-(3,5-dimethylphenyl)pyrimidin-4-yl]amino]propyl 4-sulfamoylbenzenesulfonate |
| SMILES | Cc1cc(C)cc(-c2cc(NCCCOS(=O)(=O)c3ccc(S(N)(=O)=O)cc3)nc(N)n2)c1 |
| InChI | InChI=1S/C21H25N5O5S2/c1-14-10-15(2)12-16(11-14)19-13-20(26-21(22)25-19)24-8-3-9-31-33(29,30)18-6-4-17(5-7-18)32(23,27)28/h4-7,10-13H,3,8-9H2,1-2H3,(H2,23,27,28)(H3,22,24,25,26) |
| InChIKey | ULOAPVIZZZWVLT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|