C16H23N5 — CID 174851741
4-N-(4-aminobutyl)-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine (PubChem CID 174851741) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 4-N-(4-aminobutyl)-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-aminobutyl)-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174851741 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-N-(4-aminobutyl)-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C)cc(-c2cc(NCCCCN)nc(N)n2)c1 |
| InChI | InChI=1S/C16H23N5/c1-11-7-12(2)9-13(8-11)14-10-15(21-16(18)20-14)19-6-4-3-5-17/h7-10H,3-6,17H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | HOEWYRMBXQEFFB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|