C8H16N6 — CID 54487404
4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine (PubChem CID 54487404) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 54487404 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine |
| SMILES | NCCCCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H16N6/c9-3-1-2-4-12-7-5-6(10)13-8(11)14-7/h5H,1-4,9H2,(H5,10,11,12,13,14) |
| InChIKey | XTHDMVSUHYUOOP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|