About 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine
4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine (PubChem CID 54487404) has the molecular formula C8H16N6
and a molecular weight of 196.26 g/mol. Its IUPAC name is 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine |
| PubChem CID | 54487404 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine |
| SMILES | NCCCCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H16N6/c9-3-1-2-4-12-7-5-6(10)13-8(11)14-7/h5H,1-4,9H2,(H5,10,11,12,13,14) |
| InChIKey | XTHDMVSUHYUOOP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine?
The IUPAC name of 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine (CID 54487404) is 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine is NCCCCNc1cc(N)nc(N)n1.
What is the InChIKey of 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine?
The InChIKey is XTHDMVSUHYUOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N6/c9-3-1-2-4-12-7-5-6(10)13-8(11)14-7/h5H,1-4,9H2,(H5,10,11,12,13,14).
What are the key properties of 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine?
4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine has a molecular weight of 196.26 g/mol, XLogP of -0.21, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-aminobutyl)pyrimidine-2,4,6-triamine is sourced from PubChem (CID 54487404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).