C8H15N5 — CID 80770441
4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 80770441) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80770441 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5/c1-5(2)4-11-7-3-6(9)12-8(10)13-7/h3,5H,4H2,1-2H3,(H5,9,10,11,12,13) |
| InChIKey | DRKGKINXAIGADO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |