C7H13N5O — CID 80766455
4-N-(2-methoxyethyl)pyrimidine-2,4,6-triamine (PubChem CID 80766455) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methoxyethyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80766455 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-N-(2-methoxyethyl)pyrimidine-2,4,6-triamine |
| SMILES | COCCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C7H13N5O/c1-13-3-2-10-6-4-5(8)11-7(9)12-6/h4H,2-3H2,1H3,(H5,8,9,10,11,12) |
| InChIKey | FBHUPZSKXLPMNS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|