C12H20N4O — CID 80957499
2-cyclopropyl-4-N-(4-methoxybutyl)pyrimidine-4,6-diamine (PubChem CID 80957499) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-(4-methoxybutyl)pyrimidine-4,6-diamine.
| Compound Name | 2-cyclopropyl-4-N-(4-methoxybutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80957499 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-cyclopropyl-4-N-(4-methoxybutyl)pyrimidine-4,6-diamine |
| SMILES | COCCCCNc1cc(N)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H20N4O/c1-17-7-3-2-6-14-11-8-10(13)15-12(16-11)9-4-5-9/h8-9H,2-7H2,1H3,(H3,13,14,15,16) |
| InChIKey | AHDKNPFJJQBSDT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|