C10H16N4 — CID 80956858
2-cyclopropyl-4-N-propylpyrimidine-4,6-diamine (PubChem CID 80956858) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-propylpyrimidine-4,6-diamine.
| Compound Name | 2-cyclopropyl-4-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80956858 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-cyclopropyl-4-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(N)nc(C2CC2)n1 |
| InChI | InChI=1S/C10H16N4/c1-2-5-12-9-6-8(11)13-10(14-9)7-3-4-7/h6-7H,2-5H2,1H3,(H3,11,12,13,14) |
| InChIKey | KNALQJQDQQKJJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |