C13H17N5 — CID 80849672
4-N-[2-(2-methylphenyl)ethyl]pyrimidine-2,4,6-triamine (PubChem CID 80849672) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-N-[2-(2-methylphenyl)ethyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-[2-(2-methylphenyl)ethyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80849672 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-N-[2-(2-methylphenyl)ethyl]pyrimidine-2,4,6-triamine |
| SMILES | Cc1ccccc1CCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C13H17N5/c1-9-4-2-3-5-10(9)6-7-16-12-8-11(14)17-13(15)18-12/h2-5,8H,6-7H2,1H3,(H5,14,15,16,17,18) |
| InChIKey | GQESNEGCEALJQB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |