C13H25N5O2 — CID 106257948
1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106257948) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106257948 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | CCCNc1cc(NCC(C)(O)CCOC)nc(N)n1 |
| InChI | InChI=1S/C13H25N5O2/c1-4-6-15-10-8-11(18-12(14)17-10)16-9-13(2,19)5-7-20-3/h8,19H,4-7,9H2,1-3H3,(H4,14,15,16,17,18) |
| InChIKey | DVPSQXMKISWHQA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |