C11H19N5O2 — CID 80789524
ethyl 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]acetate (PubChem CID 80789524) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is ethyl 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 80789524 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | ethyl 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]acetate |
| SMILES | CCCNc1cc(NCC(=O)OCC)nc(N)n1 |
| InChI | InChI=1S/C11H19N5O2/c1-3-5-13-8-6-9(16-11(12)15-8)14-7-10(17)18-4-2/h6H,3-5,7H2,1-2H3,(H4,12,13,14,15,16) |
| InChIKey | ONTGEBLPOGBHOY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |