C15H26N4O2 — CID 80960937
ethyl 2-[[2-tert-butyl-6-(propylamino)pyrimidin-4-yl]amino]acetate (PubChem CID 80960937) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl 2-[[2-tert-butyl-6-(propylamino)pyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-tert-butyl-6-(propylamino)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 80960937 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | ethyl 2-[[2-tert-butyl-6-(propylamino)pyrimidin-4-yl]amino]acetate |
| SMILES | CCCNc1cc(NCC(=O)OCC)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-6-8-16-11-9-12(17-10-13(20)21-7-2)19-14(18-11)15(3,4)5/h9H,6-8,10H2,1-5H3,(H2,16,17,18,19) |
| InChIKey | UIPDLXAPNPZSCM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |