C14H22ClN3O2 — CID 80951372
ethyl 4-[(2-tert-butyl-6-chloropyrimidin-4-yl)amino]butanoate (PubChem CID 80951372) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 4-[(2-tert-butyl-6-chloropyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 4-[(2-tert-butyl-6-chloropyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 80951372 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethyl 4-[(2-tert-butyl-6-chloropyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNc1cc(Cl)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H22ClN3O2/c1-5-20-12(19)7-6-8-16-11-9-10(15)17-13(18-11)14(2,3)4/h9H,5-8H2,1-4H3,(H,16,17,18) |
| InChIKey | YZHJWBRJRMXJQI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|