C11H13ClF3N3O2 — CID 106767911
ethyl 4-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate (PubChem CID 106767911) has the molecular formula C11H13ClF3N3O2 and a molecular weight of 311.69 g/mol. Its IUPAC name is ethyl 4-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate.
| Compound Name | ethyl 4-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 106767911 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | ethyl 4-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13ClF3N3O2/c1-2-20-9(19)4-3-5-16-8-6-7(12)17-10(18-8)11(13,14)15/h6H,2-5H2,1H3,(H,16,17,18) |
| InChIKey | GRLWVEBVAOTJSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|