C10H13ClF3N3O2 — CID 106311254
2-[3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]propoxy]ethanol (PubChem CID 106311254) has the molecular formula C10H13ClF3N3O2 and a molecular weight of 299.68 g/mol. Its IUPAC name is 2-[3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311254 |
| Molecular Formula | C10H13ClF3N3O2 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]propoxy]ethanol |
| SMILES | OCCOCCCNc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13ClF3N3O2/c11-7-6-8(15-2-1-4-19-5-3-18)17-9(16-7)10(12,13)14/h6,18H,1-5H2,(H,15,16,17) |
| InChIKey | NZGRKVXRKMRALE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|