C11H11ClF3N5 — CID 106196425
6-chloro-N-[3-(1H-imidazol-2-yl)propyl]-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106196425) has the molecular formula C11H11ClF3N5 and a molecular weight of 305.69 g/mol. Its IUPAC name is 6-chloro-N-[3-(1H-imidazol-2-yl)propyl]-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[3-(1H-imidazol-2-yl)propyl]-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106196425 |
| Molecular Formula | C11H11ClF3N5 |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 6-chloro-N-[3-(1H-imidazol-2-yl)propyl]-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nc(Cl)cc(NCCCc2ncc[nH]2)n1 |
| InChI | InChI=1S/C11H11ClF3N5/c12-7-6-9(20-10(19-7)11(13,14)15)16-3-1-2-8-17-4-5-18-8/h4-6H,1-3H2,(H,17,18)(H,16,19,20) |
| InChIKey | WNPSQMSMHQRUIO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|