C13H18ClF3N4 — CID 106194008
N-[2-(azepan-1-yl)ethyl]-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106194008) has the molecular formula C13H18ClF3N4 and a molecular weight of 322.76 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106194008 |
| Molecular Formula | C13H18ClF3N4 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nc(Cl)cc(NCCN2CCCCCC2)n1 |
| InChI | InChI=1S/C13H18ClF3N4/c14-10-9-11(20-12(19-10)13(15,16)17)18-5-8-21-6-3-1-2-4-7-21/h9H,1-8H2,(H,18,19,20) |
| InChIKey | GAWQOUFWOPQKFH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |